C14H17FN2 — CID 114095347
5-fluoro-3-N-(3-tricyclo[3.2.1.02,4]octanyl)benzene-1,3-diamine (PubChem CID 114095347) has the molecular formula C14H17FN2 and a molecular weight of 232.30 g/mol. Its IUPAC name is 5-fluoro-3-N-(3-tricyclo[3.2.1.02,4]octanyl)benzene-1,3-diamine.
| Compound Name | 5-fluoro-3-N-(3-tricyclo[3.2.1.02,4]octanyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 114095347 |
| Molecular Formula | C14H17FN2 |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | 5-fluoro-3-N-(3-tricyclo[3.2.1.02,4]octanyl)benzene-1,3-diamine |
| SMILES | Nc1cc(F)cc(NC2C3C4CCC(C4)C23)c1 |
| InChI | InChI=1S/C14H17FN2/c15-9-4-10(16)6-11(5-9)17-14-12-7-1-2-8(3-7)13(12)14/h4-8,12-14,17H,1-3,16H2 |
| InChIKey | WONADMFSPBMXFU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|