About (2,5-dimethylthiophen-3-yl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol
(2,5-dimethylthiophen-3-yl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol (PubChem CID 114097109) has the molecular formula C15H20OS
and a molecular weight of 248.39 g/mol. Its IUPAC name is (2,5-dimethylthiophen-3-yl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol.
Molecular Properties
| Compound Name | (2,5-dimethylthiophen-3-yl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol |
| PubChem CID | 114097109 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (2,5-dimethylthiophen-3-yl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol |
| SMILES | Cc1cc(C(O)C2C3C4CCC(C4)C32)c(C)s1 |
| InChI | InChI=1S/C15H20OS/c1-7-5-11(8(2)17-7)15(16)14-12-9-3-4-10(6-9)13(12)14/h5,9-10,12-16H,3-4,6H2,1-2H3 |
| InChIKey | BFZXNDOUSDNTES-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2,5-dimethylthiophen-3-yl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dimethylthiophen-3-yl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol?
The IUPAC name of (2,5-dimethylthiophen-3-yl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol (CID 114097109) is (2,5-dimethylthiophen-3-yl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol.
What is the SMILES notation for (2,5-dimethylthiophen-3-yl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol?
The canonical SMILES for (2,5-dimethylthiophen-3-yl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol is Cc1cc(C(O)C2C3C4CCC(C4)C32)c(C)s1.
What is the InChIKey of (2,5-dimethylthiophen-3-yl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol?
The InChIKey is BFZXNDOUSDNTES-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20OS/c1-7-5-11(8(2)17-7)15(16)14-12-9-3-4-10(6-9)13(12)14/h5,9-10,12-16H,3-4,6H2,1-2H3.
What are the key properties of (2,5-dimethylthiophen-3-yl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol?
(2,5-dimethylthiophen-3-yl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol has a molecular weight of 248.39 g/mol, XLogP of 3.69, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dimethylthiophen-3-yl)-(3-tricyclo[3.2.1.02,4]octanyl)methanol is sourced from PubChem (CID 114097109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).