C14H23NO3 — CID 114097652
2,5-dimethyl-1-[3-(2-methylpropoxy)propyl]pyrrole-3-carboxylic acid (PubChem CID 114097652) has the molecular formula C14H23NO3 and a molecular weight of 253.34 g/mol. Its IUPAC name is 2,5-dimethyl-1-[3-(2-methylpropoxy)propyl]pyrrole-3-carboxylic acid.
| Compound Name | 2,5-dimethyl-1-[3-(2-methylpropoxy)propyl]pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 114097652 |
| Molecular Formula | C14H23NO3 |
| Molecular Weight | 253.34 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 2,5-dimethyl-1-[3-(2-methylpropoxy)propyl]pyrrole-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(C)n1CCCOCC(C)C |
| InChI | InChI=1S/C14H23NO3/c1-10(2)9-18-7-5-6-15-11(3)8-13(12(15)4)14(16)17/h8,10H,5-7,9H2,1-4H3,(H,16,17) |
| InChIKey | ISBFJUMXZAVGOX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|