C13H28N2O2 — CID 114102110
1-(2,3-dimethoxypropyl)-3-ethyl-3-methyl-1,4-diazepane (PubChem CID 114102110) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-(2,3-dimethoxypropyl)-3-ethyl-3-methyl-1,4-diazepane.
| Compound Name | 1-(2,3-dimethoxypropyl)-3-ethyl-3-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 114102110 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | 1-(2,3-dimethoxypropyl)-3-ethyl-3-methyl-1,4-diazepane |
| SMILES | CCC1(C)CN(CC(COC)OC)CCCN1 |
| InChI | InChI=1S/C13H28N2O2/c1-5-13(2)11-15(8-6-7-14-13)9-12(17-4)10-16-3/h12,14H,5-11H2,1-4H3 |
| InChIKey | CCBBYOOBRILTOF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |