C11H20F4N2 — CID 114169646
3-ethyl-3-methyl-1-(2,2,3,3-tetrafluoropropyl)-1,4-diazepane (PubChem CID 114169646) has the molecular formula C11H20F4N2 and a molecular weight of 256.29 g/mol. Its IUPAC name is 3-ethyl-3-methyl-1-(2,2,3,3-tetrafluoropropyl)-1,4-diazepane.
| Compound Name | 3-ethyl-3-methyl-1-(2,2,3,3-tetrafluoropropyl)-1,4-diazepane |
|---|---|
| PubChem CID | 114169646 |
| Molecular Formula | C11H20F4N2 |
| Molecular Weight | 256.29 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 3-ethyl-3-methyl-1-(2,2,3,3-tetrafluoropropyl)-1,4-diazepane |
| SMILES | CCC1(C)CN(CC(F)(F)C(F)F)CCCN1 |
| InChI | InChI=1S/C11H20F4N2/c1-3-10(2)7-17(6-4-5-16-10)8-11(14,15)9(12)13/h9,16H,3-8H2,1-2H3 |
| InChIKey | LXXCZDCFFXKNKX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|