C12H12BrNO2S — CID 114102812
(4-bromo-1,3-thiazol-5-yl)-[2-(methoxymethyl)phenyl]methanol (PubChem CID 114102812) has the molecular formula C12H12BrNO2S and a molecular weight of 314.20 g/mol. Its IUPAC name is (4-bromo-1,3-thiazol-5-yl)-[2-(methoxymethyl)phenyl]methanol.
| Compound Name | (4-bromo-1,3-thiazol-5-yl)-[2-(methoxymethyl)phenyl]methanol |
|---|---|
| PubChem CID | 114102812 |
| Molecular Formula | C12H12BrNO2S |
| Molecular Weight | 314.20 g/mol |
| Exact Mass | 312.98 |
| IUPAC Name | (4-bromo-1,3-thiazol-5-yl)-[2-(methoxymethyl)phenyl]methanol |
| SMILES | COCc1ccccc1C(O)c1scnc1Br |
| InChI | InChI=1S/C12H12BrNO2S/c1-16-6-8-4-2-3-5-9(8)10(15)11-12(13)14-7-17-11/h2-5,7,10,15H,6H2,1H3 |
| InChIKey | FBBWGYGGABAJMB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.20 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |