C29H30F3N3O5 — CID 11410350
5-acetyl-4-(4-cyanophenyl)-N-[3-(2-methoxyethoxy)propyl]-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3-carboxamide (PubChem CID 11410350) has the molecular formula C29H30F3N3O5 and a molecular weight of 557.57 g/mol. Its IUPAC name is 5-acetyl-4-(4-cyanophenyl)-N-[3-(2-methoxyethoxy)propyl]-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3-carboxamide.
| Compound Name | 5-acetyl-4-(4-cyanophenyl)-N-[3-(2-methoxyethoxy)propyl]-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 11410350 |
| Molecular Formula | C29H30F3N3O5 |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | 5-acetyl-4-(4-cyanophenyl)-N-[3-(2-methoxyethoxy)propyl]-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3-carboxamide |
| SMILES | COCCOCCCNC(=O)C1C(=O)N(c2cccc(C(F)(F)F)c2)C(C)=C(C(C)=O)C1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C29H30F3N3O5/c1-18-24(19(2)36)25(21-10-8-20(17-33)9-11-21)26(27(37)34-12-5-13-40-15-14-39-3)28(38)35(18)23-7-4-6-22(16-23)29(30,31)32/h4,6-11,16,25-26H,5,12-15H2,1-3H3,(H,34,37) |
| InChIKey | HZMGFDHFCIUZSC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 108.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|