C27H23F3N4O4 — CID 58638647
ethyl 2-[[4-(4-cyanophenyl)-5-isocyano-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3-carbonyl]amino]propanoate (PubChem CID 58638647) has the molecular formula C27H23F3N4O4 and a molecular weight of 524.50 g/mol. Its IUPAC name is ethyl 2-[[4-(4-cyanophenyl)-5-isocyano-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3-carbonyl]amino]propanoate.
| Compound Name | ethyl 2-[[4-(4-cyanophenyl)-5-isocyano-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 58638647 |
| Molecular Formula | C27H23F3N4O4 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | ethyl 2-[[4-(4-cyanophenyl)-5-isocyano-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3-carbonyl]amino]propanoate |
| SMILES | [C-]#[N+]C1=C(C)N(c2cccc(C(F)(F)F)c2)C(=O)C(C(=O)NC(C)C(=O)OCC)C1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C27H23F3N4O4/c1-5-38-26(37)15(2)33-24(35)22-21(18-11-9-17(14-31)10-12-18)23(32-4)16(3)34(25(22)36)20-8-6-7-19(13-20)27(28,29)30/h6-13,15,21-22H,5H2,1-3H3,(H,33,35) |
| InChIKey | UOXBOGLJMRAUCS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|