C23H19F3N4O4 — CID 58638587
N-ethyl-5-isocyano-6-methyl-4-(4-nitrophenyl)-2-oxo-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3-carboxamide (PubChem CID 58638587) has the molecular formula C23H19F3N4O4 and a molecular weight of 472.42 g/mol. Its IUPAC name is N-ethyl-5-isocyano-6-methyl-4-(4-nitrophenyl)-2-oxo-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3-carboxamide.
| Compound Name | N-ethyl-5-isocyano-6-methyl-4-(4-nitrophenyl)-2-oxo-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 58638587 |
| Molecular Formula | C23H19F3N4O4 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N-ethyl-5-isocyano-6-methyl-4-(4-nitrophenyl)-2-oxo-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3-carboxamide |
| SMILES | [C-]#[N+]C1=C(C)N(c2cccc(C(F)(F)F)c2)C(=O)C(C(=O)NCC)C1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H19F3N4O4/c1-4-28-21(31)19-18(14-8-10-16(11-9-14)30(33)34)20(27-3)13(2)29(22(19)32)17-7-5-6-15(12-17)23(24,25)26/h5-12,18-19H,4H2,1-2H3,(H,28,31) |
| InChIKey | DWOCVAMQYWQNRS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|