C21H15ClN4O2 — CID 58638633
1-(3-chlorophenyl)-4-(4-cyanophenyl)-5-isocyano-6-methyl-2-oxo-3,4-dihydropyridine-3-carboxamide (PubChem CID 58638633) has the molecular formula C21H15ClN4O2 and a molecular weight of 390.83 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-4-(4-cyanophenyl)-5-isocyano-6-methyl-2-oxo-3,4-dihydropyridine-3-carboxamide.
| Compound Name | 1-(3-chlorophenyl)-4-(4-cyanophenyl)-5-isocyano-6-methyl-2-oxo-3,4-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 58638633 |
| Molecular Formula | C21H15ClN4O2 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 1-(3-chlorophenyl)-4-(4-cyanophenyl)-5-isocyano-6-methyl-2-oxo-3,4-dihydropyridine-3-carboxamide |
| SMILES | [C-]#[N+]C1=C(C)N(c2cccc(Cl)c2)C(=O)C(C(N)=O)C1c1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H15ClN4O2/c1-12-19(25-2)17(14-8-6-13(11-23)7-9-14)18(20(24)27)21(28)26(12)16-5-3-4-15(22)10-16/h3-10,17-18H,1H3,(H2,24,27) |
| InChIKey | KTTFXHLGCFMUOY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|