C24H20F3N5O — CID 58885243
4-(4-cyanophenyl)-2-imino-5-isocyano-N,N,6-trimethyl-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3-carboxamide (PubChem CID 58885243) has the molecular formula C24H20F3N5O and a molecular weight of 451.45 g/mol. Its IUPAC name is 4-(4-cyanophenyl)-2-imino-5-isocyano-N,N,6-trimethyl-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3-carboxamide.
| Compound Name | 4-(4-cyanophenyl)-2-imino-5-isocyano-N,N,6-trimethyl-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 58885243 |
| Molecular Formula | C24H20F3N5O |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.16 |
| IUPAC Name | 4-(4-cyanophenyl)-2-imino-5-isocyano-N,N,6-trimethyl-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3-carboxamide |
| SMILES | [H]/N=C1/C(C(=O)N(C)C)C(c2ccc(C#N)cc2)C([N+]#[C-])=C(C)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H20F3N5O/c1-14-21(30-2)19(16-10-8-15(13-28)9-11-16)20(23(33)31(3)4)22(29)32(14)18-7-5-6-17(12-18)24(25,26)27/h5-12,19-20,29H,1,3-4H3/b29-22- |
| InChIKey | RNZIVSDTPWSDCT-IADYIPOJSA-N |
| XLogP | 5.01 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|