C27H26F3N3O4 — CID 91357632
diethyl 4-(4-cyanophenyl)-6-ethyl-2-imino-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 91357632) has the molecular formula C27H26F3N3O4 and a molecular weight of 513.52 g/mol. Its IUPAC name is diethyl 4-(4-cyanophenyl)-6-ethyl-2-imino-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 4-(4-cyanophenyl)-6-ethyl-2-imino-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 91357632 |
| Molecular Formula | C27H26F3N3O4 |
| Molecular Weight | 513.52 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | diethyl 4-(4-cyanophenyl)-6-ethyl-2-imino-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | [H]/N=C1\C(C(=O)OCC)C(c2ccc(C#N)cc2)C(C(=O)OCC)=C(CC)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H26F3N3O4/c1-4-20-22(25(34)36-5-2)21(17-12-10-16(15-31)11-13-17)23(26(35)37-6-3)24(32)33(20)19-9-7-8-18(14-19)27(28,29)30/h7-14,21,23,32H,4-6H2,1-3H3/b32-24+ |
| InChIKey | AIUZQGBWWBAHCI-FEZSWGLMSA-N |
| XLogP | 5.56 |
| TPSA | 103.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|