C28H26F3N3O6 — CID 90822757
triethyl 4-(4-cyanophenyl)-2-imino-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5,6-tricarboxylate (PubChem CID 90822757) has the molecular formula C28H26F3N3O6 and a molecular weight of 557.53 g/mol. Its IUPAC name is triethyl 4-(4-cyanophenyl)-2-imino-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5,6-tricarboxylate.
| Compound Name | triethyl 4-(4-cyanophenyl)-2-imino-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5,6-tricarboxylate |
|---|---|
| PubChem CID | 90822757 |
| Molecular Formula | C28H26F3N3O6 |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | triethyl 4-(4-cyanophenyl)-2-imino-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5,6-tricarboxylate |
| SMILES | [H]/N=C1\C(C(=O)OCC)C(c2ccc(C#N)cc2)C(C(=O)OCC)=C(C(=O)OCC)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H26F3N3O6/c1-4-38-25(35)21-20(17-12-10-16(15-32)11-13-17)22(26(36)39-5-2)24(33)34(23(21)27(37)40-6-3)19-9-7-8-18(14-19)28(29,30)31/h7-14,20,22,33H,4-6H2,1-3H3/b33-24+ |
| InChIKey | GUFHFTINTJRANY-IWBSIUBASA-N |
| XLogP | 4.72 |
| TPSA | 129.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|