C29H30F3N3O5 — CID 91074741
3-O-butyl 5-O-(2-methoxyethyl) 4-(4-cyanophenyl)-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 91074741) has the molecular formula C29H30F3N3O5 and a molecular weight of 557.57 g/mol. Its IUPAC name is 3-O-butyl 5-O-(2-methoxyethyl) 4-(4-cyanophenyl)-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-butyl 5-O-(2-methoxyethyl) 4-(4-cyanophenyl)-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 91074741 |
| Molecular Formula | C29H30F3N3O5 |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | 3-O-butyl 5-O-(2-methoxyethyl) 4-(4-cyanophenyl)-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | [H]/N=C1\C(C(=O)OCCCC)C(c2ccc(C#N)cc2)C(C(=O)OCCOC)=C(C)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C29H30F3N3O5/c1-4-5-13-39-28(37)25-24(20-11-9-19(17-33)10-12-20)23(27(36)40-15-14-38-3)18(2)35(26(25)34)22-8-6-7-21(16-22)29(30,31)32/h6-12,16,24-25,34H,4-5,13-15H2,1-3H3/b34-26+ |
| InChIKey | MNDHRXHRVSAIIJ-JJNGWGCYSA-N |
| XLogP | 5.58 |
| TPSA | 112.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|