C25H24BrF3N2O5 — CID 91510013
5-O-(2-methoxyethyl) 3-O-methyl 4-(4-bromophenyl)-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 91510013) has the molecular formula C25H24BrF3N2O5 and a molecular weight of 569.37 g/mol. Its IUPAC name is 5-O-(2-methoxyethyl) 3-O-methyl 4-(4-bromophenyl)-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 5-O-(2-methoxyethyl) 3-O-methyl 4-(4-bromophenyl)-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 91510013 |
| Molecular Formula | C25H24BrF3N2O5 |
| Molecular Weight | 569.37 g/mol |
| Exact Mass | 568.08 |
| IUPAC Name | 5-O-(2-methoxyethyl) 3-O-methyl 4-(4-bromophenyl)-2-imino-6-methyl-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | [H]/N=C1\C(C(=O)OC)C(c2ccc(Br)cc2)C(C(=O)OCCOC)=C(C)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H24BrF3N2O5/c1-14-19(24(33)36-12-11-34-2)20(15-7-9-17(26)10-8-15)21(23(32)35-3)22(30)31(14)18-6-4-5-16(13-18)25(27,28)29/h4-10,13,20-21,30H,11-12H2,1-3H3/b30-22+ |
| InChIKey | FIXLCHOFZRFINV-JBASAIQMSA-N |
| XLogP | 5.30 |
| TPSA | 88.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.37 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|