C28H24F3N3O5 — CID 91182475
diethyl 2-imino-4-(5-isocyano-1-benzofuran-2-yl)-6-methyl-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 91182475) has the molecular formula C28H24F3N3O5 and a molecular weight of 539.51 g/mol. Its IUPAC name is diethyl 2-imino-4-(5-isocyano-1-benzofuran-2-yl)-6-methyl-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2-imino-4-(5-isocyano-1-benzofuran-2-yl)-6-methyl-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 91182475 |
| Molecular Formula | C28H24F3N3O5 |
| Molecular Weight | 539.51 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | diethyl 2-imino-4-(5-isocyano-1-benzofuran-2-yl)-6-methyl-1-[3-(trifluoromethyl)phenyl]-3,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | [H]/N=C1\C(C(=O)OCC)C(c2cc3cc([N+]#[C-])ccc3o2)C(C(=O)OCC)=C(C)N1c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C28H24F3N3O5/c1-5-37-26(35)22-15(3)34(19-9-7-8-17(14-19)28(29,30)31)25(32)24(27(36)38-6-2)23(22)21-13-16-12-18(33-4)10-11-20(16)39-21/h7-14,23-24,32H,5-6H2,1-3H3/b32-25+ |
| InChIKey | WPILEKHIZTWLMV-WGPBWIAQSA-N |
| XLogP | 6.60 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.51 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|