C30H60O5Si3 — CID 11410667
(2R)-2-[(Z,3S,5R,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-triethylsilyloxyhept-1-enyl]-2,3-dihydropyran-6-one (PubChem CID 11410667) has the molecular formula C30H60O5Si3 and a molecular weight of 585.06 g/mol. Its IUPAC name is (2R)-2-[(Z,3S,5R,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-triethylsilyloxyhept-1-enyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(Z,3S,5R,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-triethylsilyloxyhept-1-enyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 11410667 |
| Molecular Formula | C30H60O5Si3 |
| Molecular Weight | 585.06 g/mol |
| Exact Mass | 584.37 |
| IUPAC Name | (2R)-2-[(Z,3S,5R,6S)-3,6-bis[[tert-butyl(dimethyl)silyl]oxy]-5-triethylsilyloxyhept-1-enyl]-2,3-dihydropyran-6-one |
| SMILES | CC[Si](CC)(CC)O[C@H](C[C@@H](/C=C\[C@H]1CC=CC(=O)O1)O[Si](C)(C)C(C)(C)C)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H60O5Si3/c1-15-38(16-2,17-3)35-27(24(4)33-36(11,12)29(5,6)7)23-26(34-37(13,14)30(8,9)10)22-21-25-19-18-20-28(31)32-25/h18,20-22,24-27H,15-17,19,23H2,1-14H3/b22-21-/t24-,25+,26+,27+/m0/s1 |
| InChIKey | XNWNIFVIWTUERP-QAUDGAHSSA-N |
| XLogP | 9.00 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.06 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|