C11H9FN4O2 — CID 114111227
5-fluoro-2-(pyrimidin-4-ylmethylamino)pyridine-3-carboxylic acid (PubChem CID 114111227) has the molecular formula C11H9FN4O2 and a molecular weight of 248.22 g/mol. Its IUPAC name is 5-fluoro-2-(pyrimidin-4-ylmethylamino)pyridine-3-carboxylic acid.
| Compound Name | 5-fluoro-2-(pyrimidin-4-ylmethylamino)pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114111227 |
| Molecular Formula | C11H9FN4O2 |
| Molecular Weight | 248.22 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | 5-fluoro-2-(pyrimidin-4-ylmethylamino)pyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cc(F)cnc1NCc1ccncn1 |
| InChI | InChI=1S/C11H9FN4O2/c12-7-3-9(11(17)18)10(14-4-7)15-5-8-1-2-13-6-16-8/h1-4,6H,5H2,(H,14,15)(H,17,18) |
| InChIKey | QIKGYYCBBXWRPR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.22 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |