C28H28N6O8S — CID 11411274
3-[[7-[(4-carbamimidoylbenzoyl)amino]-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl]amino]-3-[(4-methylphenyl)sulfonylamino]propanoic acid (PubChem CID 11411274) has the molecular formula C28H28N6O8S and a molecular weight of 608.63 g/mol. Its IUPAC name is 3-[[7-[(4-carbamimidoylbenzoyl)amino]-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl]amino]-3-[(4-methylphenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[[7-[(4-carbamimidoylbenzoyl)amino]-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl]amino]-3-[(4-methylphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 11411274 |
| Molecular Formula | C28H28N6O8S |
| Molecular Weight | 608.63 g/mol |
| Exact Mass | 608.17 |
| IUPAC Name | 3-[[7-[(4-carbamimidoylbenzoyl)amino]-2-methyl-3-oxo-4H-1,4-benzoxazine-2-carbonyl]amino]-3-[(4-methylphenyl)sulfonylamino]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)Nc2ccc3c(c2)OC(C)(C(=O)NC(CC(=O)O)NS(=O)(=O)c2ccc(C)cc2)C(=O)N3)cc1 |
| InChI | InChI=1S/C28H28N6O8S/c1-15-3-10-19(11-4-15)43(40,41)34-22(14-23(35)36)33-27(39)28(2)26(38)32-20-12-9-18(13-21(20)42-28)31-25(37)17-7-5-16(6-8-17)24(29)30/h3-13,22,34H,14H2,1-2H3,(H3,29,30)(H,31,37)(H,32,38)(H,33,39)(H,35,36) |
| InChIKey | VHNPBLQFSJNTBO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 229.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.63 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|