C15H20FNOS — CID 114115942
2-fluoro-N-[(1-methylsulfanylcyclohexyl)methyl]benzamide (PubChem CID 114115942) has the molecular formula C15H20FNOS and a molecular weight of 281.40 g/mol. Its IUPAC name is 2-fluoro-N-[(1-methylsulfanylcyclohexyl)methyl]benzamide.
| Compound Name | 2-fluoro-N-[(1-methylsulfanylcyclohexyl)methyl]benzamide |
|---|---|
| PubChem CID | 114115942 |
| Molecular Formula | C15H20FNOS |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 2-fluoro-N-[(1-methylsulfanylcyclohexyl)methyl]benzamide |
| SMILES | CSC1(CNC(=O)c2ccccc2F)CCCCC1 |
| InChI | InChI=1S/C15H20FNOS/c1-19-15(9-5-2-6-10-15)11-17-14(18)12-7-3-4-8-13(12)16/h3-4,7-8H,2,5-6,9-11H2,1H3,(H,17,18) |
| InChIKey | YPSPZIIXOWTUEU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |