C19H36N2O2S — CID 114116040
tert-butyl N-[4-[(1-methylsulfanylcyclohexyl)methylamino]cyclohexyl]carbamate (PubChem CID 114116040) has the molecular formula C19H36N2O2S and a molecular weight of 356.58 g/mol. Its IUPAC name is tert-butyl N-[4-[(1-methylsulfanylcyclohexyl)methylamino]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[(1-methylsulfanylcyclohexyl)methylamino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 114116040 |
| Molecular Formula | C19H36N2O2S |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | tert-butyl N-[4-[(1-methylsulfanylcyclohexyl)methylamino]cyclohexyl]carbamate |
| SMILES | CSC1(CNC2CCC(NC(=O)OC(C)(C)C)CC2)CCCCC1 |
| InChI | InChI=1S/C19H36N2O2S/c1-18(2,3)23-17(22)21-16-10-8-15(9-11-16)20-14-19(24-4)12-6-5-7-13-19/h15-16,20H,5-14H2,1-4H3,(H,21,22) |
| InChIKey | DGDIKRWDGAOAPW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |