C11H16N4O4 — CID 114120646
2-[4-[(3-ethoxycyclobutyl)carbamoyl]triazol-1-yl]acetic acid (PubChem CID 114120646) has the molecular formula C11H16N4O4 and a molecular weight of 268.27 g/mol. Its IUPAC name is 2-[4-[(3-ethoxycyclobutyl)carbamoyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[(3-ethoxycyclobutyl)carbamoyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 114120646 |
| Molecular Formula | C11H16N4O4 |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 2-[4-[(3-ethoxycyclobutyl)carbamoyl]triazol-1-yl]acetic acid |
| SMILES | CCOC1CC(NC(=O)c2cn(CC(=O)O)nn2)C1 |
| InChI | InChI=1S/C11H16N4O4/c1-2-19-8-3-7(4-8)12-11(18)9-5-15(14-13-9)6-10(16)17/h5,7-8H,2-4,6H2,1H3,(H,12,18)(H,16,17) |
| InChIKey | OVZHANDTZZQONT-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |