C13H18N2S2 — CID 114121508
5-[[(2-ethylsulfanylcyclopentyl)amino]methyl]thiophene-3-carbonitrile (PubChem CID 114121508) has the molecular formula C13H18N2S2 and a molecular weight of 266.43 g/mol. Its IUPAC name is 5-[[(2-ethylsulfanylcyclopentyl)amino]methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[[(2-ethylsulfanylcyclopentyl)amino]methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 114121508 |
| Molecular Formula | C13H18N2S2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 5-[[(2-ethylsulfanylcyclopentyl)amino]methyl]thiophene-3-carbonitrile |
| SMILES | CCSC1CCCC1NCc1cc(C#N)cs1 |
| InChI | InChI=1S/C13H18N2S2/c1-2-16-13-5-3-4-12(13)15-8-11-6-10(7-14)9-17-11/h6,9,12-13,15H,2-5,8H2,1H3 |
| InChIKey | XGKZCSDAMCUKIH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |