C11H14N2OS — CID 79553461
5-[(oxan-4-ylamino)methyl]thiophene-3-carbonitrile (PubChem CID 79553461) has the molecular formula C11H14N2OS and a molecular weight of 222.31 g/mol. Its IUPAC name is 5-[(oxan-4-ylamino)methyl]thiophene-3-carbonitrile.
| Compound Name | 5-[(oxan-4-ylamino)methyl]thiophene-3-carbonitrile |
|---|---|
| PubChem CID | 79553461 |
| Molecular Formula | C11H14N2OS |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 5-[(oxan-4-ylamino)methyl]thiophene-3-carbonitrile |
| SMILES | N#Cc1csc(CNC2CCOCC2)c1 |
| InChI | InChI=1S/C11H14N2OS/c12-6-9-5-11(15-8-9)7-13-10-1-3-14-4-2-10/h5,8,10,13H,1-4,7H2 |
| InChIKey | YFLKIMQXWLCYGA-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |