C15H26N2S — CID 114125100
1-(6-methylsulfanylhexyl)-4,5,6,7-tetrahydroindol-4-amine (PubChem CID 114125100) has the molecular formula C15H26N2S and a molecular weight of 266.45 g/mol. Its IUPAC name is 1-(6-methylsulfanylhexyl)-4,5,6,7-tetrahydroindol-4-amine.
| Compound Name | 1-(6-methylsulfanylhexyl)-4,5,6,7-tetrahydroindol-4-amine |
|---|---|
| PubChem CID | 114125100 |
| Molecular Formula | C15H26N2S |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 1-(6-methylsulfanylhexyl)-4,5,6,7-tetrahydroindol-4-amine |
| SMILES | CSCCCCCCn1ccc2c1CCCC2N |
| InChI | InChI=1S/C15H26N2S/c1-18-12-5-3-2-4-10-17-11-9-13-14(16)7-6-8-15(13)17/h9,11,14H,2-8,10,12,16H2,1H3 |
| InChIKey | DQZVSZHLGMYKFF-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|