About CID 11412729
CID 11412729 (PubChem CID 11412729) has the molecular formula C10H15OSi
and a molecular weight of 179.31 g/mol.
Molecular Properties
| Compound Name | CID 11412729 |
| PubChem CID | 11412729 |
| Molecular Formula | C10H15OSi |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | — |
| SMILES | C[Si](C)OCCc1ccccc1 |
| InChI | InChI=1S/C10H15OSi/c1-12(2)11-9-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 |
| InChIKey | PLWJOKCJKHUWBX-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 11412729 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11412729?
The IUPAC name of CID 11412729 (CID 11412729) is not available.
What is the SMILES notation for CID 11412729?
The canonical SMILES for CID 11412729 is C[Si](C)OCCc1ccccc1.
What is the InChIKey of CID 11412729?
The InChIKey is PLWJOKCJKHUWBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15OSi/c1-12(2)11-9-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3.
What are the key properties of CID 11412729?
CID 11412729 has a molecular weight of 179.31 g/mol, XLogP of 2.50, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11412729 is sourced from PubChem (CID 11412729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).