C12H23F2NO2 — CID 114127427
1-cyclopentyl-3-[2-(2,2-difluoroethoxy)ethylamino]propan-2-ol (PubChem CID 114127427) has the molecular formula C12H23F2NO2 and a molecular weight of 251.32 g/mol. Its IUPAC name is 1-cyclopentyl-3-[2-(2,2-difluoroethoxy)ethylamino]propan-2-ol.
| Compound Name | 1-cyclopentyl-3-[2-(2,2-difluoroethoxy)ethylamino]propan-2-ol |
|---|---|
| PubChem CID | 114127427 |
| Molecular Formula | C12H23F2NO2 |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 1-cyclopentyl-3-[2-(2,2-difluoroethoxy)ethylamino]propan-2-ol |
| SMILES | OC(CNCCOCC(F)F)CC1CCCC1 |
| InChI | InChI=1S/C12H23F2NO2/c13-12(14)9-17-6-5-15-8-11(16)7-10-3-1-2-4-10/h10-12,15-16H,1-9H2 |
| InChIKey | JSHGARMBHMDQAA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|