C8H11NO4 — CID 11412782
(1S,5S)-1-(hydroxymethyl)-4,4-dimethyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione (PubChem CID 11412782) has the molecular formula C8H11NO4 and a molecular weight of 185.18 g/mol. Its IUPAC name is (1S,5S)-1-(hydroxymethyl)-4,4-dimethyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione.
| Compound Name | (1S,5S)-1-(hydroxymethyl)-4,4-dimethyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
|---|---|
| PubChem CID | 11412782 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | (1S,5S)-1-(hydroxymethyl)-4,4-dimethyl-6-oxa-2-azabicyclo[3.2.0]heptane-3,7-dione |
| SMILES | CC1(C)C(=O)N[C@]2(CO)C(=O)O[C@@H]12 |
| InChI | InChI=1S/C8H11NO4/c1-7(2)4-8(3-10,6(12)13-4)9-5(7)11/h4,10H,3H2,1-2H3,(H,9,11)/t4-,8-/m0/s1 |
| InChIKey | RBMZSQUHHICGGG-NVNXEXLPSA-N |
| XLogP | -1.20 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|