C15H22O5 — CID 72983086
1,10,11-trihydroxy-2,5,5,12-tetramethyl-8-oxatetracyclo[5.5.0.02,10.03,6]dodecan-9-one (PubChem CID 72983086) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1,10,11-trihydroxy-2,5,5,12-tetramethyl-8-oxatetracyclo[5.5.0.02,10.03,6]dodecan-9-one.
| Compound Name | 1,10,11-trihydroxy-2,5,5,12-tetramethyl-8-oxatetracyclo[5.5.0.02,10.03,6]dodecan-9-one |
|---|---|
| PubChem CID | 72983086 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 1,10,11-trihydroxy-2,5,5,12-tetramethyl-8-oxatetracyclo[5.5.0.02,10.03,6]dodecan-9-one |
| SMILES | CC1C(O)C2(O)C(=O)OC3C4C(CC4(C)C)C2(C)C13O |
| InChI | InChI=1S/C15H22O5/c1-6-9(16)15(19)11(17)20-10-8-7(5-12(8,2)3)13(15,4)14(6,10)18/h6-10,16,18-19H,5H2,1-4H3 |
| InChIKey | LLSVGPGDHSNECB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |