C17H24O5 — CID 162876844
[(1S,2S,5S,6R,8S,9S,10R,11S)-11-hydroxy-3,3,6,10-tetramethyl-7-oxo-12-oxatetracyclo[7.2.1.02,5.06,11]dodecan-8-yl] acetate (PubChem CID 162876844) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is [(1S,2S,5S,6R,8S,9S,10R,11S)-11-hydroxy-3,3,6,10-tetramethyl-7-oxo-12-oxatetracyclo[7.2.1.02,5.06,11]dodecan-8-yl] acetate.
| Compound Name | [(1S,2S,5S,6R,8S,9S,10R,11S)-11-hydroxy-3,3,6,10-tetramethyl-7-oxo-12-oxatetracyclo[7.2.1.02,5.06,11]dodecan-8-yl] acetate |
|---|---|
| PubChem CID | 162876844 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [(1S,2S,5S,6R,8S,9S,10R,11S)-11-hydroxy-3,3,6,10-tetramethyl-7-oxo-12-oxatetracyclo[7.2.1.02,5.06,11]dodecan-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(=O)[C@]2(C)[C@H]3CC(C)(C)[C@H]3[C@@H]3O[C@H]1[C@@H](C)[C@@]32O |
| InChI | InChI=1S/C17H24O5/c1-7-11-12(21-8(2)18)13(19)16(5)9-6-15(3,4)10(9)14(22-11)17(7,16)20/h7,9-12,14,20H,6H2,1-5H3/t7-,9+,10-,11+,12+,14+,16+,17-/m1/s1 |
| InChIKey | FCGDFATZPYTRDQ-XNFRXFTFSA-N |
| XLogP | 1.32 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |