C15H20O5 — CID 162768882
(3R,5S)-9-hydroxy-11,11,13,14-tetramethyl-4,7,12-trioxapentacyclo[6.4.1.11,10.03,5.05,13]tetradecan-6-one (PubChem CID 162768882) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (3R,5S)-9-hydroxy-11,11,13,14-tetramethyl-4,7,12-trioxapentacyclo[6.4.1.11,10.03,5.05,13]tetradecan-6-one.
| Compound Name | (3R,5S)-9-hydroxy-11,11,13,14-tetramethyl-4,7,12-trioxapentacyclo[6.4.1.11,10.03,5.05,13]tetradecan-6-one |
|---|---|
| PubChem CID | 162768882 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (3R,5S)-9-hydroxy-11,11,13,14-tetramethyl-4,7,12-trioxapentacyclo[6.4.1.11,10.03,5.05,13]tetradecan-6-one |
| SMILES | CC1C2C(O)C3OC(=O)[C@@]45O[C@@H]4CC1(OC2(C)C)C35C |
| InChI | InChI=1S/C15H20O5/c1-6-8-9(16)10-13(4)14(6,20-12(8,2)3)5-7-15(13,19-7)11(17)18-10/h6-10,16H,5H2,1-4H3/t6?,7-,8?,9?,10?,13?,14?,15+/m1/s1 |
| InChIKey | CTMGVJBBFCLDAO-YZIJOLIUSA-N |
| XLogP | 0.63 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|