C16H21BrO5 — CID 162768868
(3R,5S,11S)-11-(bromomethyl)-9-hydroxy-11,13,14,14-tetramethyl-4,7,12-trioxapentacyclo[6.4.1.11,10.03,5.05,13]tetradecan-6-one (PubChem CID 162768868) has the molecular formula C16H21BrO5 and a molecular weight of 373.24 g/mol. Its IUPAC name is (3R,5S,11S)-11-(bromomethyl)-9-hydroxy-11,13,14,14-tetramethyl-4,7,12-trioxapentacyclo[6.4.1.11,10.03,5.05,13]tetradecan-6-one.
| Compound Name | (3R,5S,11S)-11-(bromomethyl)-9-hydroxy-11,13,14,14-tetramethyl-4,7,12-trioxapentacyclo[6.4.1.11,10.03,5.05,13]tetradecan-6-one |
|---|---|
| PubChem CID | 162768868 |
| Molecular Formula | C16H21BrO5 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | (3R,5S,11S)-11-(bromomethyl)-9-hydroxy-11,13,14,14-tetramethyl-4,7,12-trioxapentacyclo[6.4.1.11,10.03,5.05,13]tetradecan-6-one |
| SMILES | CC1(C)C2C(O)C3OC(=O)[C@@]45O[C@@H]4CC1(O[C@]2(C)CBr)C35C |
| InChI | InChI=1S/C16H21BrO5/c1-12(2)9-8(18)10-14(4)15(12,22-13(9,3)6-17)5-7-16(14,21-7)11(19)20-10/h7-10,18H,5-6H2,1-4H3/t7-,8?,9?,10?,13-,14?,15?,16+/m1/s1 |
| InChIKey | QYWJNTSFZVJRAK-XRIPZNLOSA-N |
| XLogP | 1.40 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|