C15H18BrIO6 — CID 167094211
[(4R,10S)-10-(bromomethyl)-12-iodo-2,10,12-trimethyl-5-oxo-3,6,11-trioxatetracyclo[7.2.1.11,4.02,7]tridecan-8-yl] formate (PubChem CID 167094211) has the molecular formula C15H18BrIO6 and a molecular weight of 501.11 g/mol. Its IUPAC name is [(4R,10S)-10-(bromomethyl)-12-iodo-2,10,12-trimethyl-5-oxo-3,6,11-trioxatetracyclo[7.2.1.11,4.02,7]tridecan-8-yl] formate.
| Compound Name | [(4R,10S)-10-(bromomethyl)-12-iodo-2,10,12-trimethyl-5-oxo-3,6,11-trioxatetracyclo[7.2.1.11,4.02,7]tridecan-8-yl] formate |
|---|---|
| PubChem CID | 167094211 |
| Molecular Formula | C15H18BrIO6 |
| Molecular Weight | 501.11 g/mol |
| Exact Mass | 499.93 |
| IUPAC Name | [(4R,10S)-10-(bromomethyl)-12-iodo-2,10,12-trimethyl-5-oxo-3,6,11-trioxatetracyclo[7.2.1.11,4.02,7]tridecan-8-yl] formate |
| SMILES | CC1(I)C2C(OC=O)C3OC(=O)[C@H]4CC1(O[C@]2(C)CBr)C3(C)O4 |
| InChI | InChI=1S/C15H18BrIO6/c1-12(5-16)9-8(20-6-18)10-14(3)15(23-12,13(9,2)17)4-7(22-14)11(19)21-10/h6-10H,4-5H2,1-3H3/t7-,8?,9?,10?,12-,13?,14?,15?/m1/s1 |
| InChIKey | LFPBBCMXSWUDHX-IVGVNXJPSA-N |
| XLogP | 1.75 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.11 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|