About [(2R,4S)-4-hydroxy-4-methylpyrrolidin-2-yl] formate
[(2R,4S)-4-hydroxy-4-methylpyrrolidin-2-yl] formate (PubChem CID 118180473) has the molecular formula C6H11NO3
and a molecular weight of 145.16 g/mol. Its IUPAC name is [(2R,4S)-4-hydroxy-4-methylpyrrolidin-2-yl] formate.
Molecular Properties
| Compound Name | [(2R,4S)-4-hydroxy-4-methylpyrrolidin-2-yl] formate |
| PubChem CID | 118180473 |
| Molecular Formula | C6H11NO3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | [(2R,4S)-4-hydroxy-4-methylpyrrolidin-2-yl] formate |
| SMILES | C[C@@]1(O)CN[C@H](OC=O)C1 |
| InChI | InChI=1S/C6H11NO3/c1-6(9)2-5(7-3-6)10-4-8/h4-5,7,9H,2-3H2,1H3/t5-,6+/m1/s1 |
| InChIKey | XHTFAIJTADLXMW-RITPCOANSA-N |
| XLogP | -0.77 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [(2R,4S)-4-hydroxy-4-methylpyrrolidin-2-yl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,4S)-4-hydroxy-4-methylpyrrolidin-2-yl] formate?
The IUPAC name of [(2R,4S)-4-hydroxy-4-methylpyrrolidin-2-yl] formate (CID 118180473) is [(2R,4S)-4-hydroxy-4-methylpyrrolidin-2-yl] formate.
What is the SMILES notation for [(2R,4S)-4-hydroxy-4-methylpyrrolidin-2-yl] formate?
The canonical SMILES for [(2R,4S)-4-hydroxy-4-methylpyrrolidin-2-yl] formate is C[C@@]1(O)CN[C@H](OC=O)C1.
What is the InChIKey of [(2R,4S)-4-hydroxy-4-methylpyrrolidin-2-yl] formate?
The InChIKey is XHTFAIJTADLXMW-RITPCOANSA-N. The full InChI is InChI=1S/C6H11NO3/c1-6(9)2-5(7-3-6)10-4-8/h4-5,7,9H,2-3H2,1H3/t5-,6+/m1/s1.
What are the key properties of [(2R,4S)-4-hydroxy-4-methylpyrrolidin-2-yl] formate?
[(2R,4S)-4-hydroxy-4-methylpyrrolidin-2-yl] formate has a molecular weight of 145.16 g/mol, XLogP of -0.77, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,4S)-4-hydroxy-4-methylpyrrolidin-2-yl] formate is sourced from PubChem (CID 118180473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).