C9H14F3NO3 — CID 167723790
ethyl 2-[4-hydroxy-4-(trifluoromethyl)pyrrolidin-2-yl]acetate (PubChem CID 167723790) has the molecular formula C9H14F3NO3 and a molecular weight of 241.21 g/mol. Its IUPAC name is ethyl 2-[4-hydroxy-4-(trifluoromethyl)pyrrolidin-2-yl]acetate.
| Compound Name | ethyl 2-[4-hydroxy-4-(trifluoromethyl)pyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 167723790 |
| Molecular Formula | C9H14F3NO3 |
| Molecular Weight | 241.21 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | ethyl 2-[4-hydroxy-4-(trifluoromethyl)pyrrolidin-2-yl]acetate |
| SMILES | CCOC(=O)CC1CC(O)(C(F)(F)F)CN1 |
| InChI | InChI=1S/C9H14F3NO3/c1-2-16-7(14)3-6-4-8(15,5-13-6)9(10,11)12/h6,13,15H,2-5H2,1H3 |
| InChIKey | GZCBRMNXRZNXNG-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |