C17H21BrO5 — CID 174010598
(3S,6S,12S,14R)-3-(bromomethyl)-6-hydroxy-3,5,16-trimethyl-2,7,10-trioxahexacyclo[7.6.1.01,5.04,8.012,14.012,16]hexadecan-11-one (PubChem CID 174010598) has the molecular formula C17H21BrO5 and a molecular weight of 385.25 g/mol. Its IUPAC name is (3S,6S,12S,14R)-3-(bromomethyl)-6-hydroxy-3,5,16-trimethyl-2,7,10-trioxahexacyclo[7.6.1.01,5.04,8.012,14.012,16]hexadecan-11-one.
| Compound Name | (3S,6S,12S,14R)-3-(bromomethyl)-6-hydroxy-3,5,16-trimethyl-2,7,10-trioxahexacyclo[7.6.1.01,5.04,8.012,14.012,16]hexadecan-11-one |
|---|---|
| PubChem CID | 174010598 |
| Molecular Formula | C17H21BrO5 |
| Molecular Weight | 385.25 g/mol |
| Exact Mass | 384.06 |
| IUPAC Name | (3S,6S,12S,14R)-3-(bromomethyl)-6-hydroxy-3,5,16-trimethyl-2,7,10-trioxahexacyclo[7.6.1.01,5.04,8.012,14.012,16]hexadecan-11-one |
| SMILES | CC1(CBr)OC23C[C@H]4C[C@]45C(=O)OC(C4O[C@H](O)C2(C)C41)C35C |
| InChI | InChI=1S/C17H21BrO5/c1-13(6-18)9-8-10-15(3)16(12(20)22-10)4-7(16)5-17(15,23-13)14(9,2)11(19)21-8/h7-11,19H,4-6H2,1-3H3/t7-,8?,9?,10?,11+,13?,14?,15?,16-,17?/m1/s1 |
| InChIKey | KAGBKJPUUZKZHU-AIZMCLCMSA-N |
| XLogP | 1.60 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|