C11H22F2N4O — CID 114128969
1-amino-3-cyclohexyl-2-[2-(2,2-difluoroethoxy)ethyl]guanidine (PubChem CID 114128969) has the molecular formula C11H22F2N4O and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-amino-3-cyclohexyl-2-[2-(2,2-difluoroethoxy)ethyl]guanidine.
| Compound Name | 1-amino-3-cyclohexyl-2-[2-(2,2-difluoroethoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 114128969 |
| Molecular Formula | C11H22F2N4O |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 1-amino-3-cyclohexyl-2-[2-(2,2-difluoroethoxy)ethyl]guanidine |
| SMILES | NN/C(=N\CCOCC(F)F)NC1CCCCC1 |
| InChI | InChI=1S/C11H22F2N4O/c12-10(13)8-18-7-6-15-11(17-14)16-9-4-2-1-3-5-9/h9-10H,1-8,14H2,(H2,15,16,17) |
| InChIKey | GVHHSYBXJLWSKD-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|