C9H18F2N4 — CID 104887788
1-amino-3-cyclohexyl-2-(2,2-difluoroethyl)guanidine (PubChem CID 104887788) has the molecular formula C9H18F2N4 and a molecular weight of 220.27 g/mol. Its IUPAC name is 1-amino-3-cyclohexyl-2-(2,2-difluoroethyl)guanidine.
| Compound Name | 1-amino-3-cyclohexyl-2-(2,2-difluoroethyl)guanidine |
|---|---|
| PubChem CID | 104887788 |
| Molecular Formula | C9H18F2N4 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 1-amino-3-cyclohexyl-2-(2,2-difluoroethyl)guanidine |
| SMILES | NN/C(=N\CC(F)F)NC1CCCCC1 |
| InChI | InChI=1S/C9H18F2N4/c10-8(11)6-13-9(15-12)14-7-4-2-1-3-5-7/h7-8H,1-6,12H2,(H2,13,14,15) |
| InChIKey | MHNAHBSZHDLKCJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|