C8H16F2N4 — CID 104887790
1-amino-3-cyclopentyl-2-(2,2-difluoroethyl)guanidine (PubChem CID 104887790) has the molecular formula C8H16F2N4 and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-amino-3-cyclopentyl-2-(2,2-difluoroethyl)guanidine.
| Compound Name | 1-amino-3-cyclopentyl-2-(2,2-difluoroethyl)guanidine |
|---|---|
| PubChem CID | 104887790 |
| Molecular Formula | C8H16F2N4 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 1-amino-3-cyclopentyl-2-(2,2-difluoroethyl)guanidine |
| SMILES | NN/C(=N\CC(F)F)NC1CCCC1 |
| InChI | InChI=1S/C8H16F2N4/c9-7(10)5-12-8(14-11)13-6-3-1-2-4-6/h6-7H,1-5,11H2,(H2,12,13,14) |
| InChIKey | WFXGMWUXWBPAAG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|