C11H12F3N3S — CID 114129471
6-methyl-3-(4,4,4-trifluorobutan-2-yl)-1H-imidazo[4,5-b]pyridine-2-thione (PubChem CID 114129471) has the molecular formula C11H12F3N3S and a molecular weight of 275.30 g/mol. Its IUPAC name is 6-methyl-3-(4,4,4-trifluorobutan-2-yl)-1H-imidazo[4,5-b]pyridine-2-thione.
| Compound Name | 6-methyl-3-(4,4,4-trifluorobutan-2-yl)-1H-imidazo[4,5-b]pyridine-2-thione |
|---|---|
| PubChem CID | 114129471 |
| Molecular Formula | C11H12F3N3S |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 6-methyl-3-(4,4,4-trifluorobutan-2-yl)-1H-imidazo[4,5-b]pyridine-2-thione |
| SMILES | Cc1cnc2c(c1)[nH]c(=S)n2C(C)CC(F)(F)F |
| InChI | InChI=1S/C11H12F3N3S/c1-6-3-8-9(15-5-6)17(10(18)16-8)7(2)4-11(12,13)14/h3,5,7H,4H2,1-2H3,(H,16,18) |
| InChIKey | BISXVJQHTUVWBO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|