C13H23N3S — CID 114129910
2-[2-(3-ethyl-1,4-diazepan-1-yl)propan-2-yl]-1,3-thiazole (PubChem CID 114129910) has the molecular formula C13H23N3S and a molecular weight of 253.41 g/mol. Its IUPAC name is 2-[2-(3-ethyl-1,4-diazepan-1-yl)propan-2-yl]-1,3-thiazole.
| Compound Name | 2-[2-(3-ethyl-1,4-diazepan-1-yl)propan-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 114129910 |
| Molecular Formula | C13H23N3S |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | 2-[2-(3-ethyl-1,4-diazepan-1-yl)propan-2-yl]-1,3-thiazole |
| SMILES | CCC1CN(C(C)(C)c2nccs2)CCCN1 |
| InChI | InChI=1S/C13H23N3S/c1-4-11-10-16(8-5-6-14-11)13(2,3)12-15-7-9-17-12/h7,9,11,14H,4-6,8,10H2,1-3H3 |
| InChIKey | RDWAJQLTIRRSLU-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |