C10H18F3N3O — CID 114130979
5-methyl-N-(4,4,4-trifluorobutan-2-yl)piperazine-2-carboxamide (PubChem CID 114130979) has the molecular formula C10H18F3N3O and a molecular weight of 253.27 g/mol. Its IUPAC name is 5-methyl-N-(4,4,4-trifluorobutan-2-yl)piperazine-2-carboxamide.
| Compound Name | 5-methyl-N-(4,4,4-trifluorobutan-2-yl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 114130979 |
| Molecular Formula | C10H18F3N3O |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | 5-methyl-N-(4,4,4-trifluorobutan-2-yl)piperazine-2-carboxamide |
| SMILES | CC1CNC(C(=O)NC(C)CC(F)(F)F)CN1 |
| InChI | InChI=1S/C10H18F3N3O/c1-6(3-10(11,12)13)16-9(17)8-5-14-7(2)4-15-8/h6-8,14-15H,3-5H2,1-2H3,(H,16,17) |
| InChIKey | RANKWNRCCJCVMJ-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |