C13H15ClN4 — CID 114146607
N-[(3-chlorocyclopentyl)methyl]-1,2,4-benzotriazin-3-amine (PubChem CID 114146607) has the molecular formula C13H15ClN4 and a molecular weight of 262.74 g/mol. Its IUPAC name is N-[(3-chlorocyclopentyl)methyl]-1,2,4-benzotriazin-3-amine.
| Compound Name | N-[(3-chlorocyclopentyl)methyl]-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 114146607 |
| Molecular Formula | C13H15ClN4 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | N-[(3-chlorocyclopentyl)methyl]-1,2,4-benzotriazin-3-amine |
| SMILES | ClC1CCC(CNc2nnc3ccccc3n2)C1 |
| InChI | InChI=1S/C13H15ClN4/c14-10-6-5-9(7-10)8-15-13-16-11-3-1-2-4-12(11)17-18-13/h1-4,9-10H,5-8H2,(H,15,16,18) |
| InChIKey | JYFXVPGNSUEKIE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|