C16H28O2Si — CID 11414832
(1R)-1-[(2R,5R)-5-cyclohexyloxolan-2-yl]-3-trimethylsilylprop-2-yn-1-ol (PubChem CID 11414832) has the molecular formula C16H28O2Si and a molecular weight of 280.48 g/mol. Its IUPAC name is (1R)-1-[(2R,5R)-5-cyclohexyloxolan-2-yl]-3-trimethylsilylprop-2-yn-1-ol.
| Compound Name | (1R)-1-[(2R,5R)-5-cyclohexyloxolan-2-yl]-3-trimethylsilylprop-2-yn-1-ol |
|---|---|
| PubChem CID | 11414832 |
| Molecular Formula | C16H28O2Si |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (1R)-1-[(2R,5R)-5-cyclohexyloxolan-2-yl]-3-trimethylsilylprop-2-yn-1-ol |
| SMILES | C[Si](C)(C)C#C[C@@H](O)[C@H]1CC[C@H](C2CCCCC2)O1 |
| InChI | InChI=1S/C16H28O2Si/c1-19(2,3)12-11-14(17)16-10-9-15(18-16)13-7-5-4-6-8-13/h13-17H,4-10H2,1-3H3/t14-,15-,16-/m1/s1 |
| InChIKey | OJNWLBXFZBVUBA-BZUAXINKSA-N |
| XLogP | 3.36 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|