C14H18BrN3O — CID 114149424
N-(4-bromo-2,2-dimethylbutyl)pyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 114149424) has the molecular formula C14H18BrN3O and a molecular weight of 324.22 g/mol. Its IUPAC name is N-(4-bromo-2,2-dimethylbutyl)pyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-(4-bromo-2,2-dimethylbutyl)pyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114149424 |
| Molecular Formula | C14H18BrN3O |
| Molecular Weight | 324.22 g/mol |
| Exact Mass | 323.06 |
| IUPAC Name | N-(4-bromo-2,2-dimethylbutyl)pyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | CC(C)(CCBr)CNC(=O)c1cnn2ccccc12 |
| InChI | InChI=1S/C14H18BrN3O/c1-14(2,6-7-15)10-16-13(19)11-9-17-18-8-4-3-5-12(11)18/h3-5,8-9H,6-7,10H2,1-2H3,(H,16,19) |
| InChIKey | VEUWZIDLEYALBV-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|