C12H16N4O — CID 113265553
N-[2-(ethylamino)ethyl]pyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 113265553) has the molecular formula C12H16N4O and a molecular weight of 232.29 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]pyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-[2-(ethylamino)ethyl]pyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 113265553 |
| Molecular Formula | C12H16N4O |
| Molecular Weight | 232.29 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | N-[2-(ethylamino)ethyl]pyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | CCNCCNC(=O)c1cnn2ccccc12 |
| InChI | InChI=1S/C12H16N4O/c1-2-13-6-7-14-12(17)10-9-15-16-8-4-3-5-11(10)16/h3-5,8-9,13H,2,6-7H2,1H3,(H,14,17) |
| InChIKey | NZLFNAAHAQENPH-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|