C12H13N3O3S — CID 119241632
2-[2-(pyrazolo[1,5-a]pyridine-3-carbonylamino)ethylsulfanyl]acetic acid (PubChem CID 119241632) has the molecular formula C12H13N3O3S and a molecular weight of 279.32 g/mol. Its IUPAC name is 2-[2-(pyrazolo[1,5-a]pyridine-3-carbonylamino)ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-(pyrazolo[1,5-a]pyridine-3-carbonylamino)ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119241632 |
| Molecular Formula | C12H13N3O3S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-[2-(pyrazolo[1,5-a]pyridine-3-carbonylamino)ethylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCNC(=O)c1cnn2ccccc12 |
| InChI | InChI=1S/C12H13N3O3S/c16-11(17)8-19-6-4-13-12(18)9-7-14-15-5-2-1-3-10(9)15/h1-3,5,7H,4,6,8H2,(H,13,18)(H,16,17) |
| InChIKey | KMPQJFUWQJZKHH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|