C13H16BrN3O — CID 114147488
N-(4-bromopentyl)pyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 114147488) has the molecular formula C13H16BrN3O and a molecular weight of 310.19 g/mol. Its IUPAC name is N-(4-bromopentyl)pyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-(4-bromopentyl)pyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 114147488 |
| Molecular Formula | C13H16BrN3O |
| Molecular Weight | 310.19 g/mol |
| Exact Mass | 309.05 |
| IUPAC Name | N-(4-bromopentyl)pyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | CC(Br)CCCNC(=O)c1cnn2ccccc12 |
| InChI | InChI=1S/C13H16BrN3O/c1-10(14)5-4-7-15-13(18)11-9-16-17-8-3-2-6-12(11)17/h2-3,6,8-10H,4-5,7H2,1H3,(H,15,18) |
| InChIKey | VXXGBLMVWXCYQU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.19 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|