C15H20N4O — CID 175830935
N-(3-pyrrolidin-1-ylpropyl)pyrazolo[1,5-a]pyridine-3-carboxamide (PubChem CID 175830935) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is N-(3-pyrrolidin-1-ylpropyl)pyrazolo[1,5-a]pyridine-3-carboxamide.
| Compound Name | N-(3-pyrrolidin-1-ylpropyl)pyrazolo[1,5-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175830935 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | N-(3-pyrrolidin-1-ylpropyl)pyrazolo[1,5-a]pyridine-3-carboxamide |
| SMILES | O=C(NCCCN1CCCC1)c1cnn2ccccc12 |
| InChI | InChI=1S/C15H20N4O/c20-15(16-7-5-10-18-8-3-4-9-18)13-12-17-19-11-2-1-6-14(13)19/h1-2,6,11-12H,3-5,7-10H2,(H,16,20) |
| InChIKey | XIRLIOFPUZOEAH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|