About ethyl (2Z,4E)-2-acetyloxy-6-hydroxy-6-phenylhexa-2,4-dienoate
ethyl (2Z,4E)-2-acetyloxy-6-hydroxy-6-phenylhexa-2,4-dienoate (PubChem CID 11415060) has the molecular formula C16H18O5
and a molecular weight of 290.32 g/mol. Its IUPAC name is ethyl (2Z,4E)-2-acetyloxy-6-hydroxy-6-phenylhexa-2,4-dienoate.
Molecular Properties
| Compound Name | ethyl (2Z,4E)-2-acetyloxy-6-hydroxy-6-phenylhexa-2,4-dienoate |
| PubChem CID | 11415060 |
| Molecular Formula | C16H18O5 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | ethyl (2Z,4E)-2-acetyloxy-6-hydroxy-6-phenylhexa-2,4-dienoate |
| SMILES | CCOC(=O)/C(=C/C=C/C(O)c1ccccc1)OC(C)=O |
| InChI | InChI=1S/C16H18O5/c1-3-20-16(19)15(21-12(2)17)11-7-10-14(18)13-8-5-4-6-9-13/h4-11,14,18H,3H2,1-2H3/b10-7+,15-11- |
| InChIKey | MMAKAIGXAGSEJM-XGQUATGFSA-N |
| XLogP | 2.29 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z,4E)-2-acetyloxy-6-hydroxy-6-phenylhexa-2,4-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z,4E)-2-acetyloxy-6-hydroxy-6-phenylhexa-2,4-dienoate?
The IUPAC name of ethyl (2Z,4E)-2-acetyloxy-6-hydroxy-6-phenylhexa-2,4-dienoate (CID 11415060) is ethyl (2Z,4E)-2-acetyloxy-6-hydroxy-6-phenylhexa-2,4-dienoate.
What is the SMILES notation for ethyl (2Z,4E)-2-acetyloxy-6-hydroxy-6-phenylhexa-2,4-dienoate?
The canonical SMILES for ethyl (2Z,4E)-2-acetyloxy-6-hydroxy-6-phenylhexa-2,4-dienoate is CCOC(=O)/C(=C/C=C/C(O)c1ccccc1)OC(C)=O.
What is the InChIKey of ethyl (2Z,4E)-2-acetyloxy-6-hydroxy-6-phenylhexa-2,4-dienoate?
The InChIKey is MMAKAIGXAGSEJM-XGQUATGFSA-N. The full InChI is InChI=1S/C16H18O5/c1-3-20-16(19)15(21-12(2)17)11-7-10-14(18)13-8-5-4-6-9-13/h4-11,14,18H,3H2,1-2H3/b10-7+,15-11-.
What are the key properties of ethyl (2Z,4E)-2-acetyloxy-6-hydroxy-6-phenylhexa-2,4-dienoate?
ethyl (2Z,4E)-2-acetyloxy-6-hydroxy-6-phenylhexa-2,4-dienoate has a molecular weight of 290.32 g/mol, XLogP of 2.29, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z,4E)-2-acetyloxy-6-hydroxy-6-phenylhexa-2,4-dienoate is sourced from PubChem (CID 11415060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).